C20H15IN2O5 — CID 168538346
5-[[[2-(3-iodophenyl)-1,3-benzoxazol-5-yl]amino]methylidene]-2,2-dimethyl-1,3-dioxane-4,6-dione (PubChem CID 168538346) has the molecular formula C20H15IN2O5 and a molecular weight of 490.25 g/mol. Its IUPAC name is 5-[[[2-(3-iodophenyl)-1,3-benzoxazol-5-yl]amino]methylidene]-2,2-dimethyl-1,3-dioxane-4,6-dione.
| Compound Name | 5-[[[2-(3-iodophenyl)-1,3-benzoxazol-5-yl]amino]methylidene]-2,2-dimethyl-1,3-dioxane-4,6-dione |
|---|---|
| PubChem CID | 168538346 |
| Molecular Formula | C20H15IN2O5 |
| Molecular Weight | 490.25 g/mol |
| Exact Mass | 490.00 |
| IUPAC Name | 5-[[[2-(3-iodophenyl)-1,3-benzoxazol-5-yl]amino]methylidene]-2,2-dimethyl-1,3-dioxane-4,6-dione |
| SMILES | CC1(C)OC(=O)C(=CNc2ccc3oc(-c4cccc(I)c4)nc3c2)C(=O)O1 |
| InChI | InChI=1S/C20H15IN2O5/c1-20(2)27-18(24)14(19(25)28-20)10-22-13-6-7-16-15(9-13)23-17(26-16)11-4-3-5-12(21)8-11/h3-10,22H,1-2H3 |
| InChIKey | HKTOQPMWDBETPQ-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 90.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.25 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|