C19H14ClN3S — CID 168581849
N-[(2-chloro-1,3-thiazol-5-yl)methyl]-4-quinolin-3-ylaniline (PubChem CID 168581849) has the molecular formula C19H14ClN3S and a molecular weight of 351.86 g/mol. Its IUPAC name is N-[(2-chloro-1,3-thiazol-5-yl)methyl]-4-quinolin-3-ylaniline.
| Compound Name | N-[(2-chloro-1,3-thiazol-5-yl)methyl]-4-quinolin-3-ylaniline |
|---|---|
| PubChem CID | 168581849 |
| Molecular Formula | C19H14ClN3S |
| Molecular Weight | 351.86 g/mol |
| Exact Mass | 351.06 |
| IUPAC Name | N-[(2-chloro-1,3-thiazol-5-yl)methyl]-4-quinolin-3-ylaniline |
| SMILES | Clc1ncc(CNc2ccc(-c3cnc4ccccc4c3)cc2)s1 |
| InChI | InChI=1S/C19H14ClN3S/c20-19-23-12-17(24-19)11-21-16-7-5-13(6-8-16)15-9-14-3-1-2-4-18(14)22-10-15/h1-10,12,21H,11H2 |
| InChIKey | PHILVKBFJTUTKR-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.86 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |