C17H20Cl2N4O2S — CID 168583525
ethyl 4-[2-chloro-4-[(2-chloro-1,3-thiazol-5-yl)methylamino]phenyl]piperazine-1-carboxylate (PubChem CID 168583525) has the molecular formula C17H20Cl2N4O2S and a molecular weight of 415.35 g/mol. Its IUPAC name is ethyl 4-[2-chloro-4-[(2-chloro-1,3-thiazol-5-yl)methylamino]phenyl]piperazine-1-carboxylate.
| Compound Name | ethyl 4-[2-chloro-4-[(2-chloro-1,3-thiazol-5-yl)methylamino]phenyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 168583525 |
| Molecular Formula | C17H20Cl2N4O2S |
| Molecular Weight | 415.35 g/mol |
| Exact Mass | 414.07 |
| IUPAC Name | ethyl 4-[2-chloro-4-[(2-chloro-1,3-thiazol-5-yl)methylamino]phenyl]piperazine-1-carboxylate |
| SMILES | CCOC(=O)N1CCN(c2ccc(NCc3cnc(Cl)s3)cc2Cl)CC1 |
| InChI | InChI=1S/C17H20Cl2N4O2S/c1-2-25-17(24)23-7-5-22(6-8-23)15-4-3-12(9-14(15)18)20-10-13-11-21-16(19)26-13/h3-4,9,11,20H,2,5-8,10H2,1H3 |
| InChIKey | DCEOYKPMUPEJKU-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 57.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.35 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|