C14H15ClN2O2S — CID 168580385
ethyl 4-[(2-chloro-1,3-thiazol-5-yl)methylamino]-2-methylbenzoate (PubChem CID 168580385) has the molecular formula C14H15ClN2O2S and a molecular weight of 310.81 g/mol. Its IUPAC name is ethyl 4-[(2-chloro-1,3-thiazol-5-yl)methylamino]-2-methylbenzoate.
| Compound Name | ethyl 4-[(2-chloro-1,3-thiazol-5-yl)methylamino]-2-methylbenzoate |
|---|---|
| PubChem CID | 168580385 |
| Molecular Formula | C14H15ClN2O2S |
| Molecular Weight | 310.81 g/mol |
| Exact Mass | 310.05 |
| IUPAC Name | ethyl 4-[(2-chloro-1,3-thiazol-5-yl)methylamino]-2-methylbenzoate |
| SMILES | CCOC(=O)c1ccc(NCc2cnc(Cl)s2)cc1C |
| InChI | InChI=1S/C14H15ClN2O2S/c1-3-19-13(18)12-5-4-10(6-9(12)2)16-7-11-8-17-14(15)20-11/h4-6,8,16H,3,7H2,1-2H3 |
| InChIKey | ODLWYMZGHLNERJ-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.81 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |