C19H22N2O4 — CID 169335178
tert-butyl 8-(5-formylfuran-2-yl)-1,2,3,5-tetrahydro-1,4-benzodiazepine-4-carboxylate (PubChem CID 169335178) has the molecular formula C19H22N2O4 and a molecular weight of 342.40 g/mol. Its IUPAC name is tert-butyl 8-(5-formylfuran-2-yl)-1,2,3,5-tetrahydro-1,4-benzodiazepine-4-carboxylate.
| Compound Name | tert-butyl 8-(5-formylfuran-2-yl)-1,2,3,5-tetrahydro-1,4-benzodiazepine-4-carboxylate |
|---|---|
| PubChem CID | 169335178 |
| Molecular Formula | C19H22N2O4 |
| Molecular Weight | 342.40 g/mol |
| Exact Mass | 342.16 |
| IUPAC Name | tert-butyl 8-(5-formylfuran-2-yl)-1,2,3,5-tetrahydro-1,4-benzodiazepine-4-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCNc2cc(-c3ccc(C=O)o3)ccc2C1 |
| InChI | InChI=1S/C19H22N2O4/c1-19(2,3)25-18(23)21-9-8-20-16-10-13(4-5-14(16)11-21)17-7-6-15(12-22)24-17/h4-7,10,12,20H,8-9,11H2,1-3H3 |
| InChIKey | OMSXYWVCMJWRCS-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 71.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.40 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|