C22H33F2N3O2 — CID 172591464
tert-butyl 4-[[4-(4-amino-2-fluorophenyl)piperidin-1-yl]methyl]-4-fluoropiperidine-1-carboxylate (PubChem CID 172591464) has the molecular formula C22H33F2N3O2 and a molecular weight of 409.52 g/mol. Its IUPAC name is tert-butyl 4-[[4-(4-amino-2-fluorophenyl)piperidin-1-yl]methyl]-4-fluoropiperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[[4-(4-amino-2-fluorophenyl)piperidin-1-yl]methyl]-4-fluoropiperidine-1-carboxylate |
|---|---|
| PubChem CID | 172591464 |
| Molecular Formula | C22H33F2N3O2 |
| Molecular Weight | 409.52 g/mol |
| Exact Mass | 409.25 |
| IUPAC Name | tert-butyl 4-[[4-(4-amino-2-fluorophenyl)piperidin-1-yl]methyl]-4-fluoropiperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(F)(CN2CCC(c3ccc(N)cc3F)CC2)CC1 |
| InChI | InChI=1S/C22H33F2N3O2/c1-21(2,3)29-20(28)27-12-8-22(24,9-13-27)15-26-10-6-16(7-11-26)18-5-4-17(25)14-19(18)23/h4-5,14,16H,6-13,15,25H2,1-3H3 |
| InChIKey | RJGGTSSBRXHFMC-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 58.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.52 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|