C24H37FN2O4 — CID 170073420
tert-butyl 4-[4-(3-ethoxycarbonylpentylamino)-2-fluorophenyl]piperidine-1-carboxylate (PubChem CID 170073420) has the molecular formula C24H37FN2O4 and a molecular weight of 436.57 g/mol. Its IUPAC name is tert-butyl 4-[4-(3-ethoxycarbonylpentylamino)-2-fluorophenyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[4-(3-ethoxycarbonylpentylamino)-2-fluorophenyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 170073420 |
| Molecular Formula | C24H37FN2O4 |
| Molecular Weight | 436.57 g/mol |
| Exact Mass | 436.27 |
| IUPAC Name | tert-butyl 4-[4-(3-ethoxycarbonylpentylamino)-2-fluorophenyl]piperidine-1-carboxylate |
| SMILES | CCOC(=O)C(CC)CCNc1ccc(C2CCN(C(=O)OC(C)(C)C)CC2)c(F)c1 |
| InChI | InChI=1S/C24H37FN2O4/c1-6-17(22(28)30-7-2)10-13-26-19-8-9-20(21(25)16-19)18-11-14-27(15-12-18)23(29)31-24(3,4)5/h8-9,16-18,26H,6-7,10-15H2,1-5H3 |
| InChIKey | QWJXLSXAXJJXHO-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.57 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |