C20H27F3N2O4 — CID 70644364
tert-butyl 4-[2-(ethoxycarbonylamino)-5-(trifluoromethyl)phenyl]piperidine-1-carboxylate (PubChem CID 70644364) has the molecular formula C20H27F3N2O4 and a molecular weight of 416.44 g/mol. Its IUPAC name is tert-butyl 4-[2-(ethoxycarbonylamino)-5-(trifluoromethyl)phenyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[2-(ethoxycarbonylamino)-5-(trifluoromethyl)phenyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 70644364 |
| Molecular Formula | C20H27F3N2O4 |
| Molecular Weight | 416.44 g/mol |
| Exact Mass | 416.19 |
| IUPAC Name | tert-butyl 4-[2-(ethoxycarbonylamino)-5-(trifluoromethyl)phenyl]piperidine-1-carboxylate |
| SMILES | CCOC(=O)Nc1ccc(C(F)(F)F)cc1C1CCN(C(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C20H27F3N2O4/c1-5-28-17(26)24-16-7-6-14(20(21,22)23)12-15(16)13-8-10-25(11-9-13)18(27)29-19(2,3)4/h6-7,12-13H,5,8-11H2,1-4H3,(H,24,26) |
| InChIKey | QOQUGWDATCUQAM-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.44 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |