C24H33F3N2O5 — CID 130187221
tert-butyl 4-[2-(3-ethylperoxycarbonylpyrrolidin-1-yl)-4-(trifluoromethyl)phenyl]piperidine-1-carboxylate (PubChem CID 130187221) has the molecular formula C24H33F3N2O5 and a molecular weight of 486.53 g/mol. Its IUPAC name is tert-butyl 4-[2-(3-ethylperoxycarbonylpyrrolidin-1-yl)-4-(trifluoromethyl)phenyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[2-(3-ethylperoxycarbonylpyrrolidin-1-yl)-4-(trifluoromethyl)phenyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 130187221 |
| Molecular Formula | C24H33F3N2O5 |
| Molecular Weight | 486.53 g/mol |
| Exact Mass | 486.23 |
| IUPAC Name | tert-butyl 4-[2-(3-ethylperoxycarbonylpyrrolidin-1-yl)-4-(trifluoromethyl)phenyl]piperidine-1-carboxylate |
| SMILES | CCOOC(=O)C1CCN(c2cc(C(F)(F)F)ccc2C2CCN(C(=O)OC(C)(C)C)CC2)C1 |
| InChI | InChI=1S/C24H33F3N2O5/c1-5-32-34-21(30)17-10-13-29(15-17)20-14-18(24(25,26)27)6-7-19(20)16-8-11-28(12-9-16)22(31)33-23(2,3)4/h6-7,14,16-17H,5,8-13,15H2,1-4H3 |
| InChIKey | WXSSGEKYTIJLNB-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 68.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.53 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|