C25H35N3O4 — CID 118551049
tert-butyl 4-[4-cyano-2-(4-ethoxycarbonylpiperidin-1-yl)phenyl]piperidine-1-carboxylate (PubChem CID 118551049) has the molecular formula C25H35N3O4 and a molecular weight of 441.57 g/mol. Its IUPAC name is tert-butyl 4-[4-cyano-2-(4-ethoxycarbonylpiperidin-1-yl)phenyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[4-cyano-2-(4-ethoxycarbonylpiperidin-1-yl)phenyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 118551049 |
| Molecular Formula | C25H35N3O4 |
| Molecular Weight | 441.57 g/mol |
| Exact Mass | 441.26 |
| IUPAC Name | tert-butyl 4-[4-cyano-2-(4-ethoxycarbonylpiperidin-1-yl)phenyl]piperidine-1-carboxylate |
| SMILES | CCOC(=O)C1CCN(c2cc(C#N)ccc2C2CCN(C(=O)OC(C)(C)C)CC2)CC1 |
| InChI | InChI=1S/C25H35N3O4/c1-5-31-23(29)20-10-12-27(13-11-20)22-16-18(17-26)6-7-21(22)19-8-14-28(15-9-19)24(30)32-25(2,3)4/h6-7,16,19-20H,5,8-15H2,1-4H3 |
| InChIKey | FIMWOQKFDQKZRH-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 82.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.57 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |