C11H20N2 — CID 141237445
1-pentan-3-ylcyclohexa-3,5-diene-1,3-diamine (PubChem CID 141237445) has the molecular formula C11H20N2 and a molecular weight of 180.30 g/mol. Its IUPAC name is 1-pentan-3-ylcyclohexa-3,5-diene-1,3-diamine.
| Compound Name | 1-pentan-3-ylcyclohexa-3,5-diene-1,3-diamine |
|---|---|
| PubChem CID | 141237445 |
| Molecular Formula | C11H20N2 |
| Molecular Weight | 180.30 g/mol |
| Exact Mass | 180.16 |
| IUPAC Name | 1-pentan-3-ylcyclohexa-3,5-diene-1,3-diamine |
| SMILES | CCC(CC)C1(N)C=CC=C(N)C1 |
| InChI | InChI=1S/C11H20N2/c1-3-9(4-2)11(13)7-5-6-10(12)8-11/h5-7,9H,3-4,8,12-13H2,1-2H3 |
| InChIKey | CTIMITOCEAVWDV-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.30 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |