C10H12 — CID 163565857
1-ethyl-4-ethynylcyclohexa-1,3-diene (PubChem CID 163565857) has the molecular formula C10H12 and a molecular weight of 132.21 g/mol. Its IUPAC name is 1-ethyl-4-ethynylcyclohexa-1,3-diene.
| Compound Name | 1-ethyl-4-ethynylcyclohexa-1,3-diene |
|---|---|
| PubChem CID | 163565857 |
| Molecular Formula | C10H12 |
| Molecular Weight | 132.21 g/mol |
| Exact Mass | 132.09 |
| IUPAC Name | 1-ethyl-4-ethynylcyclohexa-1,3-diene |
| SMILES | C#CC1=CC=C(CC)CC1 |
| InChI | InChI=1S/C10H12/c1-3-9-5-7-10(4-2)8-6-9/h1,5,7H,4,6,8H2,2H3 |
| InChIKey | FVCTYJLKIVGTJT-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 132.21 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|