C11H13F — CID 143106967
1-(2-fluoroethynyl)-4-propylcyclohexa-1,3-diene (PubChem CID 143106967) has the molecular formula C11H13F and a molecular weight of 164.22 g/mol. Its IUPAC name is 1-(2-fluoroethynyl)-4-propylcyclohexa-1,3-diene.
| Compound Name | 1-(2-fluoroethynyl)-4-propylcyclohexa-1,3-diene |
|---|---|
| PubChem CID | 143106967 |
| Molecular Formula | C11H13F |
| Molecular Weight | 164.22 g/mol |
| Exact Mass | 164.10 |
| IUPAC Name | 1-(2-fluoroethynyl)-4-propylcyclohexa-1,3-diene |
| SMILES | CCCC1=CC=C(C#CF)CC1 |
| InChI | InChI=1S/C11H13F/c1-2-3-10-4-6-11(7-5-10)8-9-12/h4,6H,2-3,5,7H2,1H3 |
| InChIKey | YZQJEVNJGOSTAX-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.22 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|