C12H24FN — CID 143299864
ethane;2-(4-fluorocyclohexa-1,3-dien-1-yl)ethanamine (PubChem CID 143299864) has the molecular formula C12H24FN and a molecular weight of 201.33 g/mol. Its IUPAC name is ethane;2-(4-fluorocyclohexa-1,3-dien-1-yl)ethanamine.
| Compound Name | ethane;2-(4-fluorocyclohexa-1,3-dien-1-yl)ethanamine |
|---|---|
| PubChem CID | 143299864 |
| Molecular Formula | C12H24FN |
| Molecular Weight | 201.33 g/mol |
| Exact Mass | 201.19 |
| IUPAC Name | ethane;2-(4-fluorocyclohexa-1,3-dien-1-yl)ethanamine |
| SMILES | CC.CC.NCCC1=CC=C(F)CC1 |
| InChI | InChI=1S/C8H12FN.2C2H6/c9-8-3-1-7(2-4-8)5-6-10;2*1-2/h1,3H,2,4-6,10H2;2*1-2H3 |
| InChIKey | RXYNHSGEJNDYGF-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.33 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |