About 3-(4-fluorocyclohepta-1,3,5-trien-1-yl)propan-1-amine
3-(4-fluorocyclohepta-1,3,5-trien-1-yl)propan-1-amine (PubChem CID 143109956) has the molecular formula C10H14FN
and a molecular weight of 167.23 g/mol. Its IUPAC name is 3-(4-fluorocyclohepta-1,3,5-trien-1-yl)propan-1-amine.
Analyze 3-(4-fluorocyclohepta-1,3,5-trien-1-yl)propan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4-fluorocyclohepta-1,3,5-trien-1-yl)propan-1-amine?
The IUPAC name of 3-(4-fluorocyclohepta-1,3,5-trien-1-yl)propan-1-amine (CID 143109956) is 3-(4-fluorocyclohepta-1,3,5-trien-1-yl)propan-1-amine.
What is the SMILES notation for 3-(4-fluorocyclohepta-1,3,5-trien-1-yl)propan-1-amine?
The canonical SMILES for 3-(4-fluorocyclohepta-1,3,5-trien-1-yl)propan-1-amine is NCCCC1=CC=C(F)C=CC1.
What is the InChIKey of 3-(4-fluorocyclohepta-1,3,5-trien-1-yl)propan-1-amine?
The InChIKey is LJSJRZSPONUSKH-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14FN/c11-10-5-1-3-9(6-7-10)4-2-8-12/h1,5-7H,2-4,8,12H2.
What are the key properties of 3-(4-fluorocyclohepta-1,3,5-trien-1-yl)propan-1-amine?
3-(4-fluorocyclohepta-1,3,5-trien-1-yl)propan-1-amine has a molecular weight of 167.23 g/mol, XLogP of 2.46, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-fluorocyclohepta-1,3,5-trien-1-yl)propan-1-amine is sourced from PubChem (CID 143109956), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).