C8H7Br — CID 145313146
1-bromo-4-ethynylcyclohexa-1,3-diene (PubChem CID 145313146) has the molecular formula C8H7Br and a molecular weight of 183.05 g/mol. Its IUPAC name is 1-bromo-4-ethynylcyclohexa-1,3-diene.
| Compound Name | 1-bromo-4-ethynylcyclohexa-1,3-diene |
|---|---|
| PubChem CID | 145313146 |
| Molecular Formula | C8H7Br |
| Molecular Weight | 183.05 g/mol |
| Exact Mass | 181.97 |
| IUPAC Name | 1-bromo-4-ethynylcyclohexa-1,3-diene |
| SMILES | C#CC1=CC=C(Br)CC1 |
| InChI | InChI=1S/C8H7Br/c1-2-7-3-5-8(9)6-4-7/h1,3,5H,4,6H2 |
| InChIKey | FYNWXSLVVRKDCK-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.05 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|