C14H12O — CID 89071511
(4-ethynylcyclohexa-1,3-dien-1-yl)oxybenzene (PubChem CID 89071511) has the molecular formula C14H12O and a molecular weight of 196.25 g/mol. Its IUPAC name is (4-ethynylcyclohexa-1,3-dien-1-yl)oxybenzene.
| Compound Name | (4-ethynylcyclohexa-1,3-dien-1-yl)oxybenzene |
|---|---|
| PubChem CID | 89071511 |
| Molecular Formula | C14H12O |
| Molecular Weight | 196.25 g/mol |
| Exact Mass | 196.09 |
| IUPAC Name | (4-ethynylcyclohexa-1,3-dien-1-yl)oxybenzene |
| SMILES | C#CC1=CC=C(Oc2ccccc2)CC1 |
| InChI | InChI=1S/C14H12O/c1-2-12-8-10-14(11-9-12)15-13-6-4-3-5-7-13/h1,3-8,10H,9,11H2 |
| InChIKey | NFHZTFBWWWHANO-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.25 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|