C24H20O4S — CID 71068326
1-phenoxy-4-(4-phenoxycyclohexa-1,3-dien-1-yl)sulfonylbenzene (PubChem CID 71068326) has the molecular formula C24H20O4S and a molecular weight of 404.49 g/mol. Its IUPAC name is 1-phenoxy-4-(4-phenoxycyclohexa-1,3-dien-1-yl)sulfonylbenzene.
| Compound Name | 1-phenoxy-4-(4-phenoxycyclohexa-1,3-dien-1-yl)sulfonylbenzene |
|---|---|
| PubChem CID | 71068326 |
| Molecular Formula | C24H20O4S |
| Molecular Weight | 404.49 g/mol |
| Exact Mass | 404.11 |
| IUPAC Name | 1-phenoxy-4-(4-phenoxycyclohexa-1,3-dien-1-yl)sulfonylbenzene |
| SMILES | O=S(=O)(C1=CC=C(Oc2ccccc2)CC1)c1ccc(Oc2ccccc2)cc1 |
| InChI | InChI=1S/C24H20O4S/c25-29(26,23-15-11-21(12-16-23)27-19-7-3-1-4-8-19)24-17-13-22(14-18-24)28-20-9-5-2-6-10-20/h1-13,15-17H,14,18H2 |
| InChIKey | HICPQNLZYZIQDI-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.49 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |