C16H24 — CID 143698564
(4-ethynylcyclohexa-1,3-dien-1-yl)cycloheptane;methane (PubChem CID 143698564) has the molecular formula C16H24 and a molecular weight of 216.37 g/mol. Its IUPAC name is (4-ethynylcyclohexa-1,3-dien-1-yl)cycloheptane;methane.
| Compound Name | (4-ethynylcyclohexa-1,3-dien-1-yl)cycloheptane;methane |
|---|---|
| PubChem CID | 143698564 |
| Molecular Formula | C16H24 |
| Molecular Weight | 216.37 g/mol |
| Exact Mass | 216.19 |
| IUPAC Name | (4-ethynylcyclohexa-1,3-dien-1-yl)cycloheptane;methane |
| SMILES | C.C#CC1=CC=C(C2CCCCCC2)CC1 |
| InChI | InChI=1S/C15H20.CH4/c1-2-13-9-11-15(12-10-13)14-7-5-3-4-6-8-14;/h1,9,11,14H,3-8,10,12H2;1H4 |
| InChIKey | CDZAFSWHAYJWQL-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.37 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|