C14H24 — CID 144632405
1-cyclohexyl-4-methylcyclohexa-1,3-diene;methane (PubChem CID 144632405) has the molecular formula C14H24 and a molecular weight of 192.35 g/mol. Its IUPAC name is 1-cyclohexyl-4-methylcyclohexa-1,3-diene;methane.
| Compound Name | 1-cyclohexyl-4-methylcyclohexa-1,3-diene;methane |
|---|---|
| PubChem CID | 144632405 |
| Molecular Formula | C14H24 |
| Molecular Weight | 192.35 g/mol |
| Exact Mass | 192.19 |
| IUPAC Name | 1-cyclohexyl-4-methylcyclohexa-1,3-diene;methane |
| SMILES | C.CC1=CC=C(C2CCCCC2)CC1 |
| InChI | InChI=1S/C13H20.CH4/c1-11-7-9-13(10-8-11)12-5-3-2-4-6-12;/h7,9,12H,2-6,8,10H2,1H3;1H4 |
| InChIKey | LMCREAQNGVIEHL-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.35 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |