C24H34S — CID 123806780
1-cyclohexyl-4-[2-(5-methylcyclohexa-1,3-dien-1-yl)pent-3-en-2-ylsulfanyl]cyclohexa-1,3-diene (PubChem CID 123806780) has the molecular formula C24H34S and a molecular weight of 354.60 g/mol. Its IUPAC name is 1-cyclohexyl-4-[2-(5-methylcyclohexa-1,3-dien-1-yl)pent-3-en-2-ylsulfanyl]cyclohexa-1,3-diene.
| Compound Name | 1-cyclohexyl-4-[2-(5-methylcyclohexa-1,3-dien-1-yl)pent-3-en-2-ylsulfanyl]cyclohexa-1,3-diene |
|---|---|
| PubChem CID | 123806780 |
| Molecular Formula | C24H34S |
| Molecular Weight | 354.60 g/mol |
| Exact Mass | 354.24 |
| IUPAC Name | 1-cyclohexyl-4-[2-(5-methylcyclohexa-1,3-dien-1-yl)pent-3-en-2-ylsulfanyl]cyclohexa-1,3-diene |
| SMILES | CC=CC(C)(SC1=CC=C(C2CCCCC2)CC1)C1=CC=CC(C)C1 |
| InChI | InChI=1S/C24H34S/c1-4-17-24(3,22-12-8-9-19(2)18-22)25-23-15-13-21(14-16-23)20-10-6-5-7-11-20/h4,8-9,12-13,15,17,19-20H,5-7,10-11,14,16,18H2,1-3H3 |
| InChIKey | UVBDLTWPCSJVJR-UHFFFAOYSA-N |
| XLogP | 7.76 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.60 |
| LogP ≤ 5 | 7.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|