C15H24 — CID 123503605
1-(2-cyclohexylethyl)-5-methylcyclohexa-1,3-diene (PubChem CID 123503605) has the molecular formula C15H24 and a molecular weight of 204.36 g/mol. Its IUPAC name is 1-(2-cyclohexylethyl)-5-methylcyclohexa-1,3-diene.
| Compound Name | 1-(2-cyclohexylethyl)-5-methylcyclohexa-1,3-diene |
|---|---|
| PubChem CID | 123503605 |
| Molecular Formula | C15H24 |
| Molecular Weight | 204.36 g/mol |
| Exact Mass | 204.19 |
| IUPAC Name | 1-(2-cyclohexylethyl)-5-methylcyclohexa-1,3-diene |
| SMILES | CC1C=CC=C(CCC2CCCCC2)C1 |
| InChI | InChI=1S/C15H24/c1-13-6-5-9-15(12-13)11-10-14-7-3-2-4-8-14/h5-6,9,13-14H,2-4,7-8,10-12H2,1H3 |
| InChIKey | FAAMJRUKUPXOBR-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.36 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |