C11H13N — CID 142108490
1-(5-methylcyclohexa-1,3-dien-1-yl)pyrrole (PubChem CID 142108490) has the molecular formula C11H13N and a molecular weight of 159.23 g/mol. Its IUPAC name is 1-(5-methylcyclohexa-1,3-dien-1-yl)pyrrole.
| Compound Name | 1-(5-methylcyclohexa-1,3-dien-1-yl)pyrrole |
|---|---|
| PubChem CID | 142108490 |
| Molecular Formula | C11H13N |
| Molecular Weight | 159.23 g/mol |
| Exact Mass | 159.10 |
| IUPAC Name | 1-(5-methylcyclohexa-1,3-dien-1-yl)pyrrole |
| SMILES | CC1C=CC=C(n2cccc2)C1 |
| InChI | InChI=1S/C11H13N/c1-10-5-4-6-11(9-10)12-7-2-3-8-12/h2-8,10H,9H2,1H3 |
| InChIKey | PUYFLXTWTVANMZ-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 159.23 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |