C8H12NO- — CID 163587303
N,5-dimethyl-N-oxidocyclohexa-1,3-dien-1-amine (PubChem CID 163587303) has the molecular formula C8H12NO- and a molecular weight of 138.19 g/mol. Its IUPAC name is N,5-dimethyl-N-oxidocyclohexa-1,3-dien-1-amine.
| Compound Name | N,5-dimethyl-N-oxidocyclohexa-1,3-dien-1-amine |
|---|---|
| PubChem CID | 163587303 |
| Molecular Formula | C8H12NO- |
| Molecular Weight | 138.19 g/mol |
| Exact Mass | 138.09 |
| IUPAC Name | N,5-dimethyl-N-oxidocyclohexa-1,3-dien-1-amine |
| SMILES | CC1C=CC=C(N(C)[O-])C1 |
| InChI | InChI=1S/C8H12NO/c1-7-4-3-5-8(6-7)9(2)10/h3-5,7H,6H2,1-2H3/q-1 |
| InChIKey | UBISEDOFUVMPAH-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 138.19 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|