C48H76Si — CID 91499922
bis[2-(cyclohexylmethyl)-4-(4-methylcyclohexa-1,3-dien-1-yl)-2,3,3a,4,5,6,7,7a-octahydro-1H-inden-1-yl]-dimethylsilane (PubChem CID 91499922) has the molecular formula C48H76Si and a molecular weight of 681.22 g/mol. Its IUPAC name is bis[2-(cyclohexylmethyl)-4-(4-methylcyclohexa-1,3-dien-1-yl)-2,3,3a,4,5,6,7,7a-octahydro-1H-inden-1-yl]-dimethylsilane.
| Compound Name | bis[2-(cyclohexylmethyl)-4-(4-methylcyclohexa-1,3-dien-1-yl)-2,3,3a,4,5,6,7,7a-octahydro-1H-inden-1-yl]-dimethylsilane |
|---|---|
| PubChem CID | 91499922 |
| Molecular Formula | C48H76Si |
| Molecular Weight | 681.22 g/mol |
| Exact Mass | 680.57 |
| IUPAC Name | bis[2-(cyclohexylmethyl)-4-(4-methylcyclohexa-1,3-dien-1-yl)-2,3,3a,4,5,6,7,7a-octahydro-1H-inden-1-yl]-dimethylsilane |
| SMILES | CC1=CC=C(C2CCCC3C2CC(CC2CCCCC2)C3[Si](C)(C)C2C(CC3CCCCC3)CC3C(C4=CC=C(C)CC4)CCCC32)CC1 |
| InChI | InChI=1S/C48H76Si/c1-33-21-25-37(26-22-33)41-17-11-19-43-45(41)31-39(29-35-13-7-5-8-14-35)47(43)49(3,4)48-40(30-36-15-9-6-10-16-36)32-46-42(18-12-20-44(46)48)38-27-23-34(2)24-28-38/h21,23,25,27,35-36,39-48H,5-20,22,24,26,28-32H2,1-4H3 |
| InChIKey | FLHNIKHUHNGVEI-UHFFFAOYSA-N |
| XLogP | 14.81 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 681.22 |
| LogP ≤ 5 | 14.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|