C33H42S2Si — CID 90962571
(4,10-dimethyl-5,9-dithiatricyclo[6.3.0.02,6]undeca-3,10-dien-7-yl)-dimethyl-(2-methyl-4-naphthalen-1-yl-2,3,3a,4,5,6,7,7a-octahydro-1H-inden-1-yl)silane (PubChem CID 90962571) has the molecular formula C33H42S2Si and a molecular weight of 530.92 g/mol. Its IUPAC name is (4,10-dimethyl-5,9-dithiatricyclo[6.3.0.02,6]undeca-3,10-dien-7-yl)-dimethyl-(2-methyl-4-naphthalen-1-yl-2,3,3a,4,5,6,7,7a-octahydro-1H-inden-1-yl)silane.
| Compound Name | (4,10-dimethyl-5,9-dithiatricyclo[6.3.0.02,6]undeca-3,10-dien-7-yl)-dimethyl-(2-methyl-4-naphthalen-1-yl-2,3,3a,4,5,6,7,7a-octahydro-1H-inden-1-yl)silane |
|---|---|
| PubChem CID | 90962571 |
| Molecular Formula | C33H42S2Si |
| Molecular Weight | 530.92 g/mol |
| Exact Mass | 530.25 |
| IUPAC Name | (4,10-dimethyl-5,9-dithiatricyclo[6.3.0.02,6]undeca-3,10-dien-7-yl)-dimethyl-(2-methyl-4-naphthalen-1-yl-2,3,3a,4,5,6,7,7a-octahydro-1H-inden-1-yl)silane |
| SMILES | CC1=CC2C3C=C(C)SC3C([Si](C)(C)C3C(C)CC4C(c5cccc6ccccc56)CCCC43)C2S1 |
| InChI | InChI=1S/C33H42S2Si/c1-19-16-27-25(24-13-8-11-22-10-6-7-12-23(22)24)14-9-15-26(27)32(19)36(4,5)33-30-28(17-20(2)34-30)29-18-21(3)35-31(29)33/h6-8,10-13,17-19,25-33H,9,14-16H2,1-5H3 |
| InChIKey | KTRUSWKUQRERJH-UHFFFAOYSA-N |
| XLogP | 10.11 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.92 |
| LogP ≤ 5 | 10.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|