C46H46 — CID 101142973
(1S,4aS,6aR,10R,10aR,12aS)-1,10-di(phenanthren-1-yl)-1,2,3,4,4a,5,5a,6,6a,7,8,9,10,10a,11,11a,12,12a-octadecahydrotetracene (PubChem CID 101142973) has the molecular formula C46H46 and a molecular weight of 598.87 g/mol. Its IUPAC name is (1S,4aS,6aR,10R,10aR,12aS)-1,10-di(phenanthren-1-yl)-1,2,3,4,4a,5,5a,6,6a,7,8,9,10,10a,11,11a,12,12a-octadecahydrotetracene.
| Compound Name | (1S,4aS,6aR,10R,10aR,12aS)-1,10-di(phenanthren-1-yl)-1,2,3,4,4a,5,5a,6,6a,7,8,9,10,10a,11,11a,12,12a-octadecahydrotetracene |
|---|---|
| PubChem CID | 101142973 |
| Molecular Formula | C46H46 |
| Molecular Weight | 598.87 g/mol |
| Exact Mass | 598.36 |
| IUPAC Name | (1S,4aS,6aR,10R,10aR,12aS)-1,10-di(phenanthren-1-yl)-1,2,3,4,4a,5,5a,6,6a,7,8,9,10,10a,11,11a,12,12a-octadecahydrotetracene |
| SMILES | c1ccc2c(c1)ccc1c([C@H]3CCC[C@H]4CC5C[C@H]6CCC[C@@H](c7cccc8c7ccc7ccccc78)[C@@H]6CC5C[C@@H]43)cccc12 |
| InChI | InChI=1S/C46H46/c1-3-13-35-29(9-1)21-23-43-37(35)17-7-19-39(43)41-15-5-11-31-25-33-26-32-12-6-16-42(46(32)28-34(33)27-45(31)41)40-20-8-18-38-36-14-4-2-10-30(36)22-24-44(38)40/h1-4,7-10,13-14,17-24,31-34,41-42,45-46H,5-6,11-12,15-16,25-28H2/t31-,32+,33?,34?,41+,42-,45-,46+ |
| InChIKey | AYYKIWANHFTPIQ-AWKKRVDISA-N |
| XLogP | 12.82 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.87 |
| LogP ≤ 5 | 12.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|