C18H18O — CID 91491967
6a,7,8,9,10,10a-hexahydro-6H-chrysen-5-one (PubChem CID 91491967) has the molecular formula C18H18O and a molecular weight of 250.34 g/mol. Its IUPAC name is 6a,7,8,9,10,10a-hexahydro-6H-chrysen-5-one.
| Compound Name | 6a,7,8,9,10,10a-hexahydro-6H-chrysen-5-one |
|---|---|
| PubChem CID | 91491967 |
| Molecular Formula | C18H18O |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.14 |
| IUPAC Name | 6a,7,8,9,10,10a-hexahydro-6H-chrysen-5-one |
| SMILES | O=C1CC2CCCCC2c2ccc3ccccc3c21 |
| InChI | InChI=1S/C18H18O/c19-17-11-13-6-2-3-7-14(13)16-10-9-12-5-1-4-8-15(12)18(16)17/h1,4-5,8-10,13-14H,2-3,6-7,11H2 |
| InChIKey | ATSROHJJNOEMLR-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |