C19H14 — CID 131717701
1-cyclopenta-2,4-dien-1-ylphenanthrene (PubChem CID 131717701) has the molecular formula C19H14 and a molecular weight of 242.32 g/mol. Its IUPAC name is 1-cyclopenta-2,4-dien-1-ylphenanthrene.
| Compound Name | 1-cyclopenta-2,4-dien-1-ylphenanthrene |
|---|---|
| PubChem CID | 131717701 |
| Molecular Formula | C19H14 |
| Molecular Weight | 242.32 g/mol |
| Exact Mass | 242.11 |
| IUPAC Name | 1-cyclopenta-2,4-dien-1-ylphenanthrene |
| SMILES | C1=CC(c2cccc3c2ccc2ccccc23)C=C1 |
| InChI | InChI=1S/C19H14/c1-2-7-14(6-1)17-10-5-11-18-16-9-4-3-8-15(16)12-13-19(17)18/h1-14H |
| InChIKey | IPSBLKQJGCQNLR-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.32 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|