C18H14 — CID 174715167
pentacyclo[8.8.0.02,7.03,6.011,16]octadeca-1(10),2(7),8,11,13,15,17-heptaene (PubChem CID 174715167) has the molecular formula C18H14 and a molecular weight of 230.31 g/mol. Its IUPAC name is pentacyclo[8.8.0.02,7.03,6.011,16]octadeca-1(10),2(7),8,11,13,15,17-heptaene.
| Compound Name | pentacyclo[8.8.0.02,7.03,6.011,16]octadeca-1(10),2(7),8,11,13,15,17-heptaene |
|---|---|
| PubChem CID | 174715167 |
| Molecular Formula | C18H14 |
| Molecular Weight | 230.31 g/mol |
| Exact Mass | 230.11 |
| IUPAC Name | pentacyclo[8.8.0.02,7.03,6.011,16]octadeca-1(10),2(7),8,11,13,15,17-heptaene |
| SMILES | c1ccc2c(c1)ccc1c3c(ccc12)C1CCC31 |
| InChI | InChI=1S/C18H14/c1-2-4-12-11(3-1)5-6-15-13(12)7-9-16-14-8-10-17(14)18(15)16/h1-7,9,14,17H,8,10H2 |
| InChIKey | KSQQNTXXHRYRQL-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.31 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|