C14H16N2 — CID 135045429
(1S,4R)-1,2,3,4-tetrahydrophenanthrene-1,4-diamine (PubChem CID 135045429) has the molecular formula C14H16N2 and a molecular weight of 212.30 g/mol. Its IUPAC name is (1S,4R)-1,2,3,4-tetrahydrophenanthrene-1,4-diamine.
| Compound Name | (1S,4R)-1,2,3,4-tetrahydrophenanthrene-1,4-diamine |
|---|---|
| PubChem CID | 135045429 |
| Molecular Formula | C14H16N2 |
| Molecular Weight | 212.30 g/mol |
| Exact Mass | 212.13 |
| IUPAC Name | (1S,4R)-1,2,3,4-tetrahydrophenanthrene-1,4-diamine |
| SMILES | N[C@@H]1CC[C@H](N)c2ccc3ccccc3c21 |
| InChI | InChI=1S/C14H16N2/c15-12-7-8-13(16)14-10-4-2-1-3-9(10)5-6-11(12)14/h1-6,12-13H,7-8,15-16H2/t12-,13+/m0/s1 |
| InChIKey | ONOVEGTVMCRTNA-QWHCGFSZSA-N |
| XLogP | 2.63 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.30 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |