C18H14F2 — CID 174852608
1,2-difluoro-1,2,3,4-tetrahydrochrysene (PubChem CID 174852608) has the molecular formula C18H14F2 and a molecular weight of 268.31 g/mol. Its IUPAC name is 1,2-difluoro-1,2,3,4-tetrahydrochrysene.
| Compound Name | 1,2-difluoro-1,2,3,4-tetrahydrochrysene |
|---|---|
| PubChem CID | 174852608 |
| Molecular Formula | C18H14F2 |
| Molecular Weight | 268.31 g/mol |
| Exact Mass | 268.11 |
| IUPAC Name | 1,2-difluoro-1,2,3,4-tetrahydrochrysene |
| SMILES | FC1CCc2c(ccc3c2ccc2ccccc23)C1F |
| InChI | InChI=1S/C18H14F2/c19-17-10-9-15-14-6-5-11-3-1-2-4-12(11)13(14)7-8-16(15)18(17)20/h1-8,17-18H,9-10H2 |
| InChIKey | KAHSVUDUQZDCEL-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.31 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|