C28H22O — CID 174496673
naphthalene;6-oxapentacyclo[9.8.0.02,8.05,7.012,17]nonadeca-1(11),2(8),9,12,14,16,18-heptaene (PubChem CID 174496673) has the molecular formula C28H22O and a molecular weight of 374.48 g/mol. Its IUPAC name is naphthalene;6-oxapentacyclo[9.8.0.02,8.05,7.012,17]nonadeca-1(11),2(8),9,12,14,16,18-heptaene.
| Compound Name | naphthalene;6-oxapentacyclo[9.8.0.02,8.05,7.012,17]nonadeca-1(11),2(8),9,12,14,16,18-heptaene |
|---|---|
| PubChem CID | 174496673 |
| Molecular Formula | C28H22O |
| Molecular Weight | 374.48 g/mol |
| Exact Mass | 374.17 |
| IUPAC Name | naphthalene;6-oxapentacyclo[9.8.0.02,8.05,7.012,17]nonadeca-1(11),2(8),9,12,14,16,18-heptaene |
| SMILES | c1ccc2c(c1)ccc1c3c(ccc12)C1OC1CC3.c1ccc2ccccc2c1 |
| InChI | InChI=1S/C18H14O.C10H8/c1-2-4-12-11(3-1)5-6-14-13(12)7-8-16-15(14)9-10-17-18(16)19-17;1-2-6-10-8-4-3-7-9(10)5-1/h1-8,17-18H,9-10H2;1-8H |
| InChIKey | YEJQCENLDPKOGG-UHFFFAOYSA-N |
| XLogP | 7.22 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.48 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|