C25H23N — CID 154426377
1-(2-cyclopenta-2,4-dien-1-ylnaphthalen-1-yl)-N-(2,4,6-trimethylphenyl)methanimine (PubChem CID 154426377) has the molecular formula C25H23N and a molecular weight of 337.47 g/mol. Its IUPAC name is 1-(2-cyclopenta-2,4-dien-1-ylnaphthalen-1-yl)-N-(2,4,6-trimethylphenyl)methanimine.
| Compound Name | 1-(2-cyclopenta-2,4-dien-1-ylnaphthalen-1-yl)-N-(2,4,6-trimethylphenyl)methanimine |
|---|---|
| PubChem CID | 154426377 |
| Molecular Formula | C25H23N |
| Molecular Weight | 337.47 g/mol |
| Exact Mass | 337.18 |
| IUPAC Name | 1-(2-cyclopenta-2,4-dien-1-ylnaphthalen-1-yl)-N-(2,4,6-trimethylphenyl)methanimine |
| SMILES | Cc1cc(C)c(/N=C/c2c(C3C=CC=C3)ccc3ccccc23)c(C)c1 |
| InChI | InChI=1S/C25H23N/c1-17-14-18(2)25(19(3)15-17)26-16-24-22-11-7-6-10-21(22)12-13-23(24)20-8-4-5-9-20/h4-16,20H,1-3H3/b26-16+ |
| InChIKey | OGEFUAIXHAFMRF-WGOQTCKBSA-N |
| XLogP | 6.73 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.47 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|