C29H25N — CID 23015202
1-[2-(1H-inden-1-yl)naphthalen-1-yl]-N-(2,4,6-trimethylphenyl)methanimine (PubChem CID 23015202) has the molecular formula C29H25N and a molecular weight of 387.53 g/mol. Its IUPAC name is 1-[2-(1H-inden-1-yl)naphthalen-1-yl]-N-(2,4,6-trimethylphenyl)methanimine.
| Compound Name | 1-[2-(1H-inden-1-yl)naphthalen-1-yl]-N-(2,4,6-trimethylphenyl)methanimine |
|---|---|
| PubChem CID | 23015202 |
| Molecular Formula | C29H25N |
| Molecular Weight | 387.53 g/mol |
| Exact Mass | 387.20 |
| IUPAC Name | 1-[2-(1H-inden-1-yl)naphthalen-1-yl]-N-(2,4,6-trimethylphenyl)methanimine |
| SMILES | Cc1cc(C)c(/N=C/c2c(C3C=Cc4ccccc43)ccc3ccccc23)c(C)c1 |
| InChI | InChI=1S/C29H25N/c1-19-16-20(2)29(21(3)17-19)30-18-28-25-11-7-5-9-23(25)13-15-27(28)26-14-12-22-8-4-6-10-24(22)26/h4-18,26H,1-3H3/b30-18+ |
| InChIKey | QRKIHDLHWQWSHI-UXHLAJHPSA-N |
| XLogP | 7.67 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.53 |
| LogP ≤ 5 | 7.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|