C10H13BrO — CID 130445398
1-[4-(bromomethyl)-6-methylcyclohexa-1,3-dien-1-yl]ethanone (PubChem CID 130445398) has the molecular formula C10H13BrO and a molecular weight of 229.12 g/mol. Its IUPAC name is 1-[4-(bromomethyl)-6-methylcyclohexa-1,3-dien-1-yl]ethanone.
| Compound Name | 1-[4-(bromomethyl)-6-methylcyclohexa-1,3-dien-1-yl]ethanone |
|---|---|
| PubChem CID | 130445398 |
| Molecular Formula | C10H13BrO |
| Molecular Weight | 229.12 g/mol |
| Exact Mass | 228.01 |
| IUPAC Name | 1-[4-(bromomethyl)-6-methylcyclohexa-1,3-dien-1-yl]ethanone |
| SMILES | CC(=O)C1=CC=C(CBr)CC1C |
| InChI | InChI=1S/C10H13BrO/c1-7-5-9(6-11)3-4-10(7)8(2)12/h3-4,7H,5-6H2,1-2H3 |
| InChIKey | KMVDZZNINOMQQI-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.12 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|