About 3,4-dihydroxy-6-methylcyclohexa-1,3-diene-1-carboxylic acid
3,4-dihydroxy-6-methylcyclohexa-1,3-diene-1-carboxylic acid (PubChem CID 154986965) has the molecular formula C8H10O4
and a molecular weight of 170.16 g/mol. Its IUPAC name is 3,4-dihydroxy-6-methylcyclohexa-1,3-diene-1-carboxylic acid.
Analyze 3,4-dihydroxy-6-methylcyclohexa-1,3-diene-1-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4-dihydroxy-6-methylcyclohexa-1,3-diene-1-carboxylic acid?
The IUPAC name of 3,4-dihydroxy-6-methylcyclohexa-1,3-diene-1-carboxylic acid (CID 154986965) is 3,4-dihydroxy-6-methylcyclohexa-1,3-diene-1-carboxylic acid.
What is the SMILES notation for 3,4-dihydroxy-6-methylcyclohexa-1,3-diene-1-carboxylic acid?
The canonical SMILES for 3,4-dihydroxy-6-methylcyclohexa-1,3-diene-1-carboxylic acid is CC1CC(O)=C(O)C=C1C(=O)O.
What is the InChIKey of 3,4-dihydroxy-6-methylcyclohexa-1,3-diene-1-carboxylic acid?
The InChIKey is ZNQVBGPJIBIQGF-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10O4/c1-4-2-6(9)7(10)3-5(4)8(11)12/h3-4,9-10H,2H2,1H3,(H,11,12).
What are the key properties of 3,4-dihydroxy-6-methylcyclohexa-1,3-diene-1-carboxylic acid?
3,4-dihydroxy-6-methylcyclohexa-1,3-diene-1-carboxylic acid has a molecular weight of 170.16 g/mol, XLogP of 1.36, 1 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4-dihydroxy-6-methylcyclohexa-1,3-diene-1-carboxylic acid is sourced from PubChem (CID 154986965), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).