About ethyl 2,4-dihydroxy-6-methylcyclohexa-1,3-diene-1-carboxylate
ethyl 2,4-dihydroxy-6-methylcyclohexa-1,3-diene-1-carboxylate (PubChem CID 131849152) has the molecular formula C10H14O4
and a molecular weight of 198.22 g/mol. Its IUPAC name is ethyl 2,4-dihydroxy-6-methylcyclohexa-1,3-diene-1-carboxylate.
Analyze ethyl 2,4-dihydroxy-6-methylcyclohexa-1,3-diene-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2,4-dihydroxy-6-methylcyclohexa-1,3-diene-1-carboxylate?
The IUPAC name of ethyl 2,4-dihydroxy-6-methylcyclohexa-1,3-diene-1-carboxylate (CID 131849152) is ethyl 2,4-dihydroxy-6-methylcyclohexa-1,3-diene-1-carboxylate.
What is the SMILES notation for ethyl 2,4-dihydroxy-6-methylcyclohexa-1,3-diene-1-carboxylate?
The canonical SMILES for ethyl 2,4-dihydroxy-6-methylcyclohexa-1,3-diene-1-carboxylate is CCOC(=O)C1=C(O)C=C(O)CC1C.
What is the InChIKey of ethyl 2,4-dihydroxy-6-methylcyclohexa-1,3-diene-1-carboxylate?
The InChIKey is MKNWOQMXAKXPGL-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14O4/c1-3-14-10(13)9-6(2)4-7(11)5-8(9)12/h5-6,11-12H,3-4H2,1-2H3.
What are the key properties of ethyl 2,4-dihydroxy-6-methylcyclohexa-1,3-diene-1-carboxylate?
ethyl 2,4-dihydroxy-6-methylcyclohexa-1,3-diene-1-carboxylate has a molecular weight of 198.22 g/mol, XLogP of 1.84, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2,4-dihydroxy-6-methylcyclohexa-1,3-diene-1-carboxylate is sourced from PubChem (CID 131849152), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).