ethyl 2,4-dihydroxy-6-methylcyclohexa-1,3-diene-1-carboxylate

C10H14O4 — CID 131849152

IUPACethyl 2,4-dihydroxy-6-methylcyclohexa-1,3-diene-1-carboxylate
SMILESCCOC(=O)C1=C(O)C=C(O)CC1C
InChIInChI=1S/C10H14O4/c1-3-14-10(13)9-6(2)4-7(11)5-8(9)12/h5-6,11-12H,3-4H2,1-2H3
InChIKeyMKNWOQMXAKXPGL-UHFFFAOYSA-N
MW198.22 g/mol
LogP1.84
Rot. Bonds2

About ethyl 2,4-dihydroxy-6-methylcyclohexa-1,3-diene-1-carboxylate

ethyl 2,4-dihydroxy-6-methylcyclohexa-1,3-diene-1-carboxylate (PubChem CID 131849152) has the molecular formula C10H14O4 and a molecular weight of 198.22 g/mol. Its IUPAC name is ethyl 2,4-dihydroxy-6-methylcyclohexa-1,3-diene-1-carboxylate.

Molecular Properties

Compound Nameethyl 2,4-dihydroxy-6-methylcyclohexa-1,3-diene-1-carboxylate
PubChem CID131849152
Molecular FormulaC10H14O4
Molecular Weight198.22 g/mol
Exact Mass198.09
IUPAC Nameethyl 2,4-dihydroxy-6-methylcyclohexa-1,3-diene-1-carboxylate
SMILESCCOC(=O)C1=C(O)C=C(O)CC1C
InChIInChI=1S/C10H14O4/c1-3-14-10(13)9-6(2)4-7(11)5-8(9)12/h5-6,11-12H,3-4H2,1-2H3
InChIKeyMKNWOQMXAKXPGL-UHFFFAOYSA-N
XLogP1.84
TPSA66.76 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds2
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500198.22
LogP ≤ 51.84
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Analyze ethyl 2,4-dihydroxy-6-methylcyclohexa-1,3-diene-1-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of ethyl 2,4-dihydroxy-6-methylcyclohexa-1,3-diene-1-carboxylate?
The IUPAC name of ethyl 2,4-dihydroxy-6-methylcyclohexa-1,3-diene-1-carboxylate (CID 131849152) is ethyl 2,4-dihydroxy-6-methylcyclohexa-1,3-diene-1-carboxylate.
What is the SMILES notation for ethyl 2,4-dihydroxy-6-methylcyclohexa-1,3-diene-1-carboxylate?
The canonical SMILES for ethyl 2,4-dihydroxy-6-methylcyclohexa-1,3-diene-1-carboxylate is CCOC(=O)C1=C(O)C=C(O)CC1C.
What is the InChIKey of ethyl 2,4-dihydroxy-6-methylcyclohexa-1,3-diene-1-carboxylate?
The InChIKey is MKNWOQMXAKXPGL-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14O4/c1-3-14-10(13)9-6(2)4-7(11)5-8(9)12/h5-6,11-12H,3-4H2,1-2H3.
What are the key properties of ethyl 2,4-dihydroxy-6-methylcyclohexa-1,3-diene-1-carboxylate?
ethyl 2,4-dihydroxy-6-methylcyclohexa-1,3-diene-1-carboxylate has a molecular weight of 198.22 g/mol, XLogP of 1.84, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2,4-dihydroxy-6-methylcyclohexa-1,3-diene-1-carboxylate is sourced from PubChem (CID 131849152), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).