C19H22O6 — CID 98392308
diethyl (1S,4S,5S,8R,9S,10S,12S,13R)-3,6-dihydroxypentacyclo[6.5.0.04,12.05,10.09,13]trideca-2,6-diene-2,7-dicarboxylate (PubChem CID 98392308) has the molecular formula C19H22O6 and a molecular weight of 346.38 g/mol. Its IUPAC name is diethyl (1S,4S,5S,8R,9S,10S,12S,13R)-3,6-dihydroxypentacyclo[6.5.0.04,12.05,10.09,13]trideca-2,6-diene-2,7-dicarboxylate.
| Compound Name | diethyl (1S,4S,5S,8R,9S,10S,12S,13R)-3,6-dihydroxypentacyclo[6.5.0.04,12.05,10.09,13]trideca-2,6-diene-2,7-dicarboxylate |
|---|---|
| PubChem CID | 98392308 |
| Molecular Formula | C19H22O6 |
| Molecular Weight | 346.38 g/mol |
| Exact Mass | 346.14 |
| IUPAC Name | diethyl (1S,4S,5S,8R,9S,10S,12S,13R)-3,6-dihydroxypentacyclo[6.5.0.04,12.05,10.09,13]trideca-2,6-diene-2,7-dicarboxylate |
| SMILES | CCOC(=O)C1=C(O)[C@H]2[C@H]3C[C@@H]4[C@@H]2C(O)=C(C(=O)OCC)[C@H]2[C@@H]1[C@H]3[C@H]42 |
| InChI | InChI=1S/C19H22O6/c1-3-24-18(22)14-12-8-6-5-7-9(8)13(12)15(19(23)25-4-2)17(21)11(7)10(6)16(14)20/h6-13,20-21H,3-5H2,1-2H3/t6-,7-,8-,9+,10-,11-,12+,13-/m0/s1 |
| InChIKey | GDMNLDOPKZZEJL-VXWTXJKASA-N |
| XLogP | 2.12 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.38 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |