C13H16O5 — CID 14200253
diethyl 3-oxatricyclo[3.2.1.02,4]oct-6-ene-6,7-dicarboxylate (PubChem CID 14200253) has the molecular formula C13H16O5 and a molecular weight of 252.27 g/mol. Its IUPAC name is diethyl 3-oxatricyclo[3.2.1.02,4]oct-6-ene-6,7-dicarboxylate.
| Compound Name | diethyl 3-oxatricyclo[3.2.1.02,4]oct-6-ene-6,7-dicarboxylate |
|---|---|
| PubChem CID | 14200253 |
| Molecular Formula | C13H16O5 |
| Molecular Weight | 252.27 g/mol |
| Exact Mass | 252.10 |
| IUPAC Name | diethyl 3-oxatricyclo[3.2.1.02,4]oct-6-ene-6,7-dicarboxylate |
| SMILES | CCOC(=O)C1=C(C(=O)OCC)C2CC1C1OC21 |
| InChI | InChI=1S/C13H16O5/c1-3-16-12(14)8-6-5-7(11-10(6)18-11)9(8)13(15)17-4-2/h6-7,10-11H,3-5H2,1-2H3 |
| InChIKey | SRIUTDNEGFYCJI-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 65.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.27 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|