C14H16Br2O3 — CID 11176810
ethyl (1R,2R,5S,6S)-7,8-dibromo-4-[(1S)-1-hydroxyethyl]tricyclo[4.2.1.02,5]nona-3,7-diene-3-carboxylate (PubChem CID 11176810) has the molecular formula C14H16Br2O3 and a molecular weight of 392.09 g/mol. Its IUPAC name is ethyl (1R,2R,5S,6S)-7,8-dibromo-4-[(1S)-1-hydroxyethyl]tricyclo[4.2.1.02,5]nona-3,7-diene-3-carboxylate.
| Compound Name | ethyl (1R,2R,5S,6S)-7,8-dibromo-4-[(1S)-1-hydroxyethyl]tricyclo[4.2.1.02,5]nona-3,7-diene-3-carboxylate |
|---|---|
| PubChem CID | 11176810 |
| Molecular Formula | C14H16Br2O3 |
| Molecular Weight | 392.09 g/mol |
| Exact Mass | 389.95 |
| IUPAC Name | ethyl (1R,2R,5S,6S)-7,8-dibromo-4-[(1S)-1-hydroxyethyl]tricyclo[4.2.1.02,5]nona-3,7-diene-3-carboxylate |
| SMILES | CCOC(=O)C1=C([C@H](C)O)[C@H]2[C@@H]1[C@H]1C[C@@H]2C(Br)=C1Br |
| InChI | InChI=1S/C14H16Br2O3/c1-3-19-14(18)11-8(5(2)17)9-6-4-7(10(9)11)13(16)12(6)15/h5-7,9-10,17H,3-4H2,1-2H3/t5-,6-,7+,9-,10-/m0/s1 |
| InChIKey | AICKRFPAWHAXGO-FTZBPAMFSA-N |
| XLogP | 3.12 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.09 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |