C17H18O4 — CID 101451881
ethyl (1R,8S,9R,12S)-11-(1-hydroxyethyl)-13-oxatetracyclo[6.4.1.02,7.09,12]trideca-2,4,6,10-tetraene-10-carboxylate (PubChem CID 101451881) has the molecular formula C17H18O4 and a molecular weight of 286.33 g/mol. Its IUPAC name is ethyl (1R,8S,9R,12S)-11-(1-hydroxyethyl)-13-oxatetracyclo[6.4.1.02,7.09,12]trideca-2,4,6,10-tetraene-10-carboxylate.
| Compound Name | ethyl (1R,8S,9R,12S)-11-(1-hydroxyethyl)-13-oxatetracyclo[6.4.1.02,7.09,12]trideca-2,4,6,10-tetraene-10-carboxylate |
|---|---|
| PubChem CID | 101451881 |
| Molecular Formula | C17H18O4 |
| Molecular Weight | 286.33 g/mol |
| Exact Mass | 286.12 |
| IUPAC Name | ethyl (1R,8S,9R,12S)-11-(1-hydroxyethyl)-13-oxatetracyclo[6.4.1.02,7.09,12]trideca-2,4,6,10-tetraene-10-carboxylate |
| SMILES | CCOC(=O)C1=C(C(C)O)[C@@H]2[C@H]1[C@@H]1O[C@H]2c2ccccc21 |
| InChI | InChI=1S/C17H18O4/c1-3-20-17(19)14-11(8(2)18)12-13(14)16-10-7-5-4-6-9(10)15(12)21-16/h4-8,12-13,15-16,18H,3H2,1-2H3/t8?,12-,13-,15+,16-/m1/s1 |
| InChIKey | CWBOAUWGQSKNCS-OEHFQHDOSA-N |
| XLogP | 2.30 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.33 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |