C22H28O4 — CID 102419117
diethyl (1S,3S,4S,5R,8S,9S,10R)-11,12-diethylpentacyclo[6.4.0.02,5.03,10.04,9]dodeca-6,11-diene-6,7-dicarboxylate (PubChem CID 102419117) has the molecular formula C22H28O4 and a molecular weight of 356.46 g/mol. Its IUPAC name is diethyl (1S,3S,4S,5R,8S,9S,10R)-11,12-diethylpentacyclo[6.4.0.02,5.03,10.04,9]dodeca-6,11-diene-6,7-dicarboxylate.
| Compound Name | diethyl (1S,3S,4S,5R,8S,9S,10R)-11,12-diethylpentacyclo[6.4.0.02,5.03,10.04,9]dodeca-6,11-diene-6,7-dicarboxylate |
|---|---|
| PubChem CID | 102419117 |
| Molecular Formula | C22H28O4 |
| Molecular Weight | 356.46 g/mol |
| Exact Mass | 356.20 |
| IUPAC Name | diethyl (1S,3S,4S,5R,8S,9S,10R)-11,12-diethylpentacyclo[6.4.0.02,5.03,10.04,9]dodeca-6,11-diene-6,7-dicarboxylate |
| SMILES | CCOC(=O)C1=C(C(=O)OCC)[C@H]2C3C4[C@H]2[C@@H]2[C@H]1[C@H]3C(CC)=C(CC)[C@H]42 |
| InChI | InChI=1S/C22H28O4/c1-5-9-10(6-2)12-14-13-11(9)15-16(12)19(21(23)25-7-3)20(18(14)17(13)15)22(24)26-8-4/h11-18H,5-8H2,1-4H3/t11-,12+,13?,14?,15+,16-,17+,18+/m1/s1 |
| InChIKey | SGQZMJYBFJVBFZ-CSWGMETMSA-N |
| XLogP | 3.52 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.46 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|