C21H30N2O6 — CID 46933119
3-O-ethyl 7-O,8-O-dipropan-2-yl (1R,2S,5R,6S)-4-ethyl-7,8-diazatricyclo[4.2.2.02,5]deca-3,9-diene-3,7,8-tricarboxylate (PubChem CID 46933119) has the molecular formula C21H30N2O6 and a molecular weight of 406.48 g/mol. Its IUPAC name is 3-O-ethyl 7-O,8-O-dipropan-2-yl (1R,2S,5R,6S)-4-ethyl-7,8-diazatricyclo[4.2.2.02,5]deca-3,9-diene-3,7,8-tricarboxylate.
| Compound Name | 3-O-ethyl 7-O,8-O-dipropan-2-yl (1R,2S,5R,6S)-4-ethyl-7,8-diazatricyclo[4.2.2.02,5]deca-3,9-diene-3,7,8-tricarboxylate |
|---|---|
| PubChem CID | 46933119 |
| Molecular Formula | C21H30N2O6 |
| Molecular Weight | 406.48 g/mol |
| Exact Mass | 406.21 |
| IUPAC Name | 3-O-ethyl 7-O,8-O-dipropan-2-yl (1R,2S,5R,6S)-4-ethyl-7,8-diazatricyclo[4.2.2.02,5]deca-3,9-diene-3,7,8-tricarboxylate |
| SMILES | CCOC(=O)C1=C(CC)[C@H]2[C@@H]1[C@H]1C=C[C@@H]2N(C(=O)OC(C)C)N1C(=O)OC(C)C |
| InChI | InChI=1S/C21H30N2O6/c1-7-13-16-14-9-10-15(18(16)17(13)19(24)27-8-2)23(21(26)29-12(5)6)22(14)20(25)28-11(3)4/h9-12,14-16,18H,7-8H2,1-6H3/t14-,15+,16+,18-/m0/s1 |
| InChIKey | KVGGKKHKZCNTER-LHHMISFZSA-N |
| XLogP | 3.43 |
| TPSA | 85.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.48 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|