C14H18Br2N2O4 — CID 124846420
diethyl (1S,2S,3R,4S,5R,6S)-3,4-dibromo-7,8-diazatricyclo[4.2.2.02,5]dec-9-ene-7,8-dicarboxylate (PubChem CID 124846420) has the molecular formula C14H18Br2N2O4 and a molecular weight of 438.12 g/mol. Its IUPAC name is diethyl (1S,2S,3R,4S,5R,6S)-3,4-dibromo-7,8-diazatricyclo[4.2.2.02,5]dec-9-ene-7,8-dicarboxylate.
| Compound Name | diethyl (1S,2S,3R,4S,5R,6S)-3,4-dibromo-7,8-diazatricyclo[4.2.2.02,5]dec-9-ene-7,8-dicarboxylate |
|---|---|
| PubChem CID | 124846420 |
| Molecular Formula | C14H18Br2N2O4 |
| Molecular Weight | 438.12 g/mol |
| Exact Mass | 435.96 |
| IUPAC Name | diethyl (1S,2S,3R,4S,5R,6S)-3,4-dibromo-7,8-diazatricyclo[4.2.2.02,5]dec-9-ene-7,8-dicarboxylate |
| SMILES | CCOC(=O)N1[C@H]2C=C[C@@H]([C@H]3[C@@H](Br)[C@@H](Br)[C@H]32)N1C(=O)OCC |
| InChI | InChI=1S/C14H18Br2N2O4/c1-3-21-13(19)17-7-5-6-8(18(17)14(20)22-4-2)10-9(7)11(15)12(10)16/h5-12H,3-4H2,1-2H3/t7-,8-,9-,10+,11-,12+/m0/s1 |
| InChIKey | ITNNVRMPCOZLJK-IQMQYZSSSA-N |
| XLogP | 2.91 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.12 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|