C13H20N2O4 — CID 12000218
diethyl (3R)-3-prop-2-enyl-3,6-dihydropyridazine-1,2-dicarboxylate (PubChem CID 12000218) has the molecular formula C13H20N2O4 and a molecular weight of 268.31 g/mol. Its IUPAC name is diethyl (3R)-3-prop-2-enyl-3,6-dihydropyridazine-1,2-dicarboxylate.
| Compound Name | diethyl (3R)-3-prop-2-enyl-3,6-dihydropyridazine-1,2-dicarboxylate |
|---|---|
| PubChem CID | 12000218 |
| Molecular Formula | C13H20N2O4 |
| Molecular Weight | 268.31 g/mol |
| Exact Mass | 268.14 |
| IUPAC Name | diethyl (3R)-3-prop-2-enyl-3,6-dihydropyridazine-1,2-dicarboxylate |
| SMILES | C=CC[C@@H]1C=CCN(C(=O)OCC)N1C(=O)OCC |
| InChI | InChI=1S/C13H20N2O4/c1-4-8-11-9-7-10-14(12(16)18-5-2)15(11)13(17)19-6-3/h4,7,9,11H,1,5-6,8,10H2,2-3H3/t11-/m1/s1 |
| InChIKey | YUIGVSAZDGZIKZ-LLVKDONJSA-N |
| XLogP | 2.33 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.31 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|