C16H20N2O4 — CID 98556608
diethyl (1R,4S,7R,8S,9R,10R)-5,6-diazapentacyclo[6.4.0.02,10.03,7.04,9]dodec-11-ene-5,6-dicarboxylate (PubChem CID 98556608) has the molecular formula C16H20N2O4 and a molecular weight of 304.35 g/mol. Its IUPAC name is diethyl (1R,4S,7R,8S,9R,10R)-5,6-diazapentacyclo[6.4.0.02,10.03,7.04,9]dodec-11-ene-5,6-dicarboxylate.
| Compound Name | diethyl (1R,4S,7R,8S,9R,10R)-5,6-diazapentacyclo[6.4.0.02,10.03,7.04,9]dodec-11-ene-5,6-dicarboxylate |
|---|---|
| PubChem CID | 98556608 |
| Molecular Formula | C16H20N2O4 |
| Molecular Weight | 304.35 g/mol |
| Exact Mass | 304.14 |
| IUPAC Name | diethyl (1R,4S,7R,8S,9R,10R)-5,6-diazapentacyclo[6.4.0.02,10.03,7.04,9]dodec-11-ene-5,6-dicarboxylate |
| SMILES | CCOC(=O)N1[C@@H]2C3C4[C@H]5C=C[C@H]4[C@@H]2[C@H]5[C@H]3N1C(=O)OCC |
| InChI | InChI=1S/C16H20N2O4/c1-3-21-15(19)17-13-10-7-5-6-8-9(7)12(13)14(11(8)10)18(17)16(20)22-4-2/h5-14H,3-4H2,1-2H3/t7-,8-,9?,10-,11+,12?,13+,14-/m1/s1 |
| InChIKey | RSHGBAWRRZYYBS-SNDFPQCMSA-N |
| XLogP | 1.88 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.35 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|