About diethyl 3-(hydroxymethyl)-3,6-dihydropyridazine-1,2-dicarboxylate
diethyl 3-(hydroxymethyl)-3,6-dihydropyridazine-1,2-dicarboxylate (PubChem CID 117061260) has the molecular formula C11H18N2O5
and a molecular weight of 258.27 g/mol. Its IUPAC name is diethyl 3-(hydroxymethyl)-3,6-dihydropyridazine-1,2-dicarboxylate.
Molecular Properties
| Compound Name | diethyl 3-(hydroxymethyl)-3,6-dihydropyridazine-1,2-dicarboxylate |
| PubChem CID | 117061260 |
| Molecular Formula | C11H18N2O5 |
| Molecular Weight | 258.27 g/mol |
| Exact Mass | 258.12 |
| IUPAC Name | diethyl 3-(hydroxymethyl)-3,6-dihydropyridazine-1,2-dicarboxylate |
| SMILES | CCOC(=O)N1CC=CC(CO)N1C(=O)OCC |
| InChI | InChI=1S/C11H18N2O5/c1-3-17-10(15)12-7-5-6-9(8-14)13(12)11(16)18-4-2/h5-6,9,14H,3-4,7-8H2,1-2H3 |
| InChIKey | DWJLLRCOOSODLC-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 79.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.27 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze diethyl 3-(hydroxymethyl)-3,6-dihydropyridazine-1,2-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diethyl 3-(hydroxymethyl)-3,6-dihydropyridazine-1,2-dicarboxylate?
The IUPAC name of diethyl 3-(hydroxymethyl)-3,6-dihydropyridazine-1,2-dicarboxylate (CID 117061260) is diethyl 3-(hydroxymethyl)-3,6-dihydropyridazine-1,2-dicarboxylate.
What is the SMILES notation for diethyl 3-(hydroxymethyl)-3,6-dihydropyridazine-1,2-dicarboxylate?
The canonical SMILES for diethyl 3-(hydroxymethyl)-3,6-dihydropyridazine-1,2-dicarboxylate is CCOC(=O)N1CC=CC(CO)N1C(=O)OCC.
What is the InChIKey of diethyl 3-(hydroxymethyl)-3,6-dihydropyridazine-1,2-dicarboxylate?
The InChIKey is DWJLLRCOOSODLC-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18N2O5/c1-3-17-10(15)12-7-5-6-9(8-14)13(12)11(16)18-4-2/h5-6,9,14H,3-4,7-8H2,1-2H3.
What are the key properties of diethyl 3-(hydroxymethyl)-3,6-dihydropyridazine-1,2-dicarboxylate?
diethyl 3-(hydroxymethyl)-3,6-dihydropyridazine-1,2-dicarboxylate has a molecular weight of 258.27 g/mol, XLogP of 0.75, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for diethyl 3-(hydroxymethyl)-3,6-dihydropyridazine-1,2-dicarboxylate is sourced from PubChem (CID 117061260), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).