C11H18N2O5 — CID 117061260
diethyl 3-(hydroxymethyl)-3,6-dihydropyridazine-1,2-dicarboxylate (PubChem CID 117061260) has the molecular formula C11H18N2O5 and a molecular weight of 258.27 g/mol. Its IUPAC name is diethyl 3-(hydroxymethyl)-3,6-dihydropyridazine-1,2-dicarboxylate.
| Compound Name | diethyl 3-(hydroxymethyl)-3,6-dihydropyridazine-1,2-dicarboxylate |
|---|---|
| PubChem CID | 117061260 |
| Molecular Formula | C11H18N2O5 |
| Molecular Weight | 258.27 g/mol |
| Exact Mass | 258.12 |
| IUPAC Name | diethyl 3-(hydroxymethyl)-3,6-dihydropyridazine-1,2-dicarboxylate |
| SMILES | CCOC(=O)N1CC=CC(CO)N1C(=O)OCC |
| InChI | InChI=1S/C11H18N2O5/c1-3-17-10(15)12-7-5-6-9(8-14)13(12)11(16)18-4-2/h5-6,9,14H,3-4,7-8H2,1-2H3 |
| InChIKey | DWJLLRCOOSODLC-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 79.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.27 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|