C16H24N2O7 — CID 102580480
diethyl (1S,6S,7S)-7-(2-ethoxy-2-oxoethyl)-4-methoxy-2,3-diazabicyclo[4.1.0]hept-4-ene-2,3-dicarboxylate (PubChem CID 102580480) has the molecular formula C16H24N2O7 and a molecular weight of 356.38 g/mol. Its IUPAC name is diethyl (1S,6S,7S)-7-(2-ethoxy-2-oxoethyl)-4-methoxy-2,3-diazabicyclo[4.1.0]hept-4-ene-2,3-dicarboxylate.
| Compound Name | diethyl (1S,6S,7S)-7-(2-ethoxy-2-oxoethyl)-4-methoxy-2,3-diazabicyclo[4.1.0]hept-4-ene-2,3-dicarboxylate |
|---|---|
| PubChem CID | 102580480 |
| Molecular Formula | C16H24N2O7 |
| Molecular Weight | 356.38 g/mol |
| Exact Mass | 356.16 |
| IUPAC Name | diethyl (1S,6S,7S)-7-(2-ethoxy-2-oxoethyl)-4-methoxy-2,3-diazabicyclo[4.1.0]hept-4-ene-2,3-dicarboxylate |
| SMILES | CCOC(=O)C[C@H]1[C@H]2C=C(OC)N(C(=O)OCC)N(C(=O)OCC)[C@H]21 |
| InChI | InChI=1S/C16H24N2O7/c1-5-23-13(19)9-11-10-8-12(22-4)17(15(20)24-6-2)18(14(10)11)16(21)25-7-3/h8,10-11,14H,5-7,9H2,1-4H3/t10-,11+,14-/m1/s1 |
| InChIKey | ZAHQEIWZWBLXNW-UHIISALHSA-N |
| XLogP | 1.89 |
| TPSA | 94.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.38 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|