C12H16N2O3 — CID 13380026
ethyl (1R,2R,3S,7R)-3,9-dimethyl-4-oxo-5,6-diazatricyclo[5.2.0.02,5]non-8-ene-6-carboxylate (PubChem CID 13380026) has the molecular formula C12H16N2O3 and a molecular weight of 236.27 g/mol. Its IUPAC name is ethyl (1R,2R,3S,7R)-3,9-dimethyl-4-oxo-5,6-diazatricyclo[5.2.0.02,5]non-8-ene-6-carboxylate.
| Compound Name | ethyl (1R,2R,3S,7R)-3,9-dimethyl-4-oxo-5,6-diazatricyclo[5.2.0.02,5]non-8-ene-6-carboxylate |
|---|---|
| PubChem CID | 13380026 |
| Molecular Formula | C12H16N2O3 |
| Molecular Weight | 236.27 g/mol |
| Exact Mass | 236.12 |
| IUPAC Name | ethyl (1R,2R,3S,7R)-3,9-dimethyl-4-oxo-5,6-diazatricyclo[5.2.0.02,5]non-8-ene-6-carboxylate |
| SMILES | CCOC(=O)N1[C@@H]2C=C(C)[C@@H]2[C@@H]2[C@H](C)C(=O)N21 |
| InChI | InChI=1S/C12H16N2O3/c1-4-17-12(16)13-8-5-6(2)9(8)10-7(3)11(15)14(10)13/h5,7-10H,4H2,1-3H3/t7-,8+,9-,10-/m0/s1 |
| InChIKey | WSQCMRWWLZMZSJ-JXUBOQSCSA-N |
| XLogP | 1.17 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.27 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|